C33H37N7O4S — CID 162133920
15-[2-(benzylamino)ethyl]-10-(oxan-4-yl)-3-thia-7,10,11,17,22,26-hexazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13,16-trione (PubChem CID 162133920) has the molecular formula C33H37N7O4S and a molecular weight of 627.77 g/mol. Its IUPAC name is 15-[2-(benzylamino)ethyl]-10-(oxan-4-yl)-3-thia-7,10,11,17,22,26-hexazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13,16-trione.
| Compound Name | 15-[2-(benzylamino)ethyl]-10-(oxan-4-yl)-3-thia-7,10,11,17,22,26-hexazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13,16-trione |
|---|---|
| PubChem CID | 162133920 |
| Molecular Formula | C33H37N7O4S |
| Molecular Weight | 627.77 g/mol |
| Exact Mass | 627.26 |
| IUPAC Name | 15-[2-(benzylamino)ethyl]-10-(oxan-4-yl)-3-thia-7,10,11,17,22,26-hexazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13,16-trione |
| SMILES | O=C1Nc2cn(C3CCOCC3)nc2C(=O)CC(CCNCc2ccccc2)C(=O)NCCCc2cc(ccn2)-c2nc1cs2 |
| InChI | InChI=1S/C33H37N7O4S/c41-29-18-23(8-13-34-19-22-5-2-1-3-6-22)31(42)36-12-4-7-25-17-24(9-14-35-25)33-38-28(21-45-33)32(43)37-27-20-40(39-30(27)29)26-10-15-44-16-11-26/h1-3,5-6,9,14,17,20-21,23,26,34H,4,7-8,10-13,15-16,18-19H2,(H,36,42)(H,37,43) |
| InChIKey | ZJACFOAMVPGPTH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 140.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.77 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|