C24H29N7O4S — CID 153256496
10-(2-morpholin-4-ylethyl)-17-oxa-3-thia-7,10,11,20,22,26-hexazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione (PubChem CID 153256496) has the molecular formula C24H29N7O4S and a molecular weight of 511.61 g/mol. Its IUPAC name is 10-(2-morpholin-4-ylethyl)-17-oxa-3-thia-7,10,11,20,22,26-hexazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione.
| Compound Name | 10-(2-morpholin-4-ylethyl)-17-oxa-3-thia-7,10,11,20,22,26-hexazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione |
|---|---|
| PubChem CID | 153256496 |
| Molecular Formula | C24H29N7O4S |
| Molecular Weight | 511.61 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | 10-(2-morpholin-4-ylethyl)-17-oxa-3-thia-7,10,11,20,22,26-hexazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione |
| SMILES | O=C1Nc2cn(CCN3CCOCC3)nc2C(=O)CCCOCCNc2cc(ccn2)-c2nc1cs2 |
| InChI | InChI=1S/C24H29N7O4S/c32-20-2-1-10-34-11-5-26-21-14-17(3-4-25-21)24-28-19(16-36-24)23(33)27-18-15-31(29-22(18)20)7-6-30-8-12-35-13-9-30/h3-4,14-16H,1-2,5-13H2,(H,25,26)(H,27,33) |
| InChIKey | WUJFJCBUVRXOHT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 123.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.61 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |