C26H30N6O5S — CID 153086570
15-(2-hydroxyethyl)-10-(oxan-4-yl)-3-thia-7,10,11,17,22,26-hexazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13,16-trione (PubChem CID 153086570) has the molecular formula C26H30N6O5S and a molecular weight of 538.63 g/mol. Its IUPAC name is 15-(2-hydroxyethyl)-10-(oxan-4-yl)-3-thia-7,10,11,17,22,26-hexazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13,16-trione.
| Compound Name | 15-(2-hydroxyethyl)-10-(oxan-4-yl)-3-thia-7,10,11,17,22,26-hexazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13,16-trione |
|---|---|
| PubChem CID | 153086570 |
| Molecular Formula | C26H30N6O5S |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | 15-(2-hydroxyethyl)-10-(oxan-4-yl)-3-thia-7,10,11,17,22,26-hexazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13,16-trione |
| SMILES | O=C1Nc2cn(C3CCOCC3)nc2C(=O)CC(CCO)C(=O)NCCCc2cc(ccn2)-c2nc1cs2 |
| InChI | InChI=1S/C26H30N6O5S/c33-9-4-16-13-22(34)23-20(14-32(31-23)19-5-10-37-11-6-19)29-25(36)21-15-38-26(30-21)17-3-8-27-18(12-17)2-1-7-28-24(16)35/h3,8,12,14-16,19,33H,1-2,4-7,9-11,13H2,(H,28,35)(H,29,36) |
| InChIKey | VOICPMXFIHDIQC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 148.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |