C28H35N7O3S — CID 157399854
10-cyclohexyl-N-ethyl-6,13-dioxo-3-thia-7,10,11,17,22,26-hexazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-17-carboxamide (PubChem CID 157399854) has the molecular formula C28H35N7O3S and a molecular weight of 549.70 g/mol. Its IUPAC name is 10-cyclohexyl-N-ethyl-6,13-dioxo-3-thia-7,10,11,17,22,26-hexazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-17-carboxamide.
| Compound Name | 10-cyclohexyl-N-ethyl-6,13-dioxo-3-thia-7,10,11,17,22,26-hexazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-17-carboxamide |
|---|---|
| PubChem CID | 157399854 |
| Molecular Formula | C28H35N7O3S |
| Molecular Weight | 549.70 g/mol |
| Exact Mass | 549.25 |
| IUPAC Name | 10-cyclohexyl-N-ethyl-6,13-dioxo-3-thia-7,10,11,17,22,26-hexazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-17-carboxamide |
| SMILES | CCNC(=O)N1CCCC(=O)c2nn(C3CCCCC3)cc2NC(=O)c2csc(n2)-c2ccnc(c2)CCC1 |
| InChI | InChI=1S/C28H35N7O3S/c1-2-29-28(38)34-14-6-8-20-16-19(12-13-30-20)27-32-23(18-39-27)26(37)31-22-17-35(21-9-4-3-5-10-21)33-25(22)24(36)11-7-15-34/h12-13,16-18,21H,2-11,14-15H2,1H3,(H,29,38)(H,31,37) |
| InChIKey | BNACFESIEJFSAK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.70 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |