C22H28N2O3 — CID 130467675
(1E,4S,10Z,13S)-4-[2-(1,5-dimethylpyrazol-3-yl)ethyl]-5-oxabicyclo[11.3.0]hexadeca-1,10,14-triene-6,16-dione (PubChem CID 130467675) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is (1E,4S,10Z,13S)-4-[2-(1,5-dimethylpyrazol-3-yl)ethyl]-5-oxabicyclo[11.3.0]hexadeca-1,10,14-triene-6,16-dione.
| Compound Name | (1E,4S,10Z,13S)-4-[2-(1,5-dimethylpyrazol-3-yl)ethyl]-5-oxabicyclo[11.3.0]hexadeca-1,10,14-triene-6,16-dione |
|---|---|
| PubChem CID | 130467675 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | (1E,4S,10Z,13S)-4-[2-(1,5-dimethylpyrazol-3-yl)ethyl]-5-oxabicyclo[11.3.0]hexadeca-1,10,14-triene-6,16-dione |
| SMILES | Cc1cc(CC[C@H]2C/C=C3/C(=O)C=C[C@@H]3C/C=C\CCCC(=O)O2)nn1C |
| InChI | InChI=1S/C22H28N2O3/c1-16-15-18(23-24(16)2)10-11-19-12-13-20-17(9-14-21(20)25)7-5-3-4-6-8-22(26)27-19/h3,5,9,13-15,17,19H,4,6-8,10-12H2,1-2H3/b5-3-,20-13+/t17-,19-/m0/s1 |
| InChIKey | WPRFTWBWOIKHKZ-XLAAJYGASA-N |
| XLogP | 3.77 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|