About ethene;methyl 5-(1-methyl-5-propan-2-ylpyrazol-3-yl)pentanoate
ethene;methyl 5-(1-methyl-5-propan-2-ylpyrazol-3-yl)pentanoate (PubChem CID 154683252) has the molecular formula C15H26N2O2
and a molecular weight of 266.38 g/mol. Its IUPAC name is ethene;methyl 5-(1-methyl-5-propan-2-ylpyrazol-3-yl)pentanoate.
Molecular Properties
| Compound Name | ethene;methyl 5-(1-methyl-5-propan-2-ylpyrazol-3-yl)pentanoate |
| PubChem CID | 154683252 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | ethene;methyl 5-(1-methyl-5-propan-2-ylpyrazol-3-yl)pentanoate |
| SMILES | C=C.COC(=O)CCCCc1cc(C(C)C)n(C)n1 |
| InChI | InChI=1S/C13H22N2O2.C2H4/c1-10(2)12-9-11(14-15(12)3)7-5-6-8-13(16)17-4;1-2/h9-10H,5-8H2,1-4H3;1-2H2 |
| InChIKey | OPLOTEKMXPIRPG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;methyl 5-(1-methyl-5-propan-2-ylpyrazol-3-yl)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;methyl 5-(1-methyl-5-propan-2-ylpyrazol-3-yl)pentanoate?
The IUPAC name of ethene;methyl 5-(1-methyl-5-propan-2-ylpyrazol-3-yl)pentanoate (CID 154683252) is ethene;methyl 5-(1-methyl-5-propan-2-ylpyrazol-3-yl)pentanoate.
What is the SMILES notation for ethene;methyl 5-(1-methyl-5-propan-2-ylpyrazol-3-yl)pentanoate?
The canonical SMILES for ethene;methyl 5-(1-methyl-5-propan-2-ylpyrazol-3-yl)pentanoate is C=C.COC(=O)CCCCc1cc(C(C)C)n(C)n1.
What is the InChIKey of ethene;methyl 5-(1-methyl-5-propan-2-ylpyrazol-3-yl)pentanoate?
The InChIKey is OPLOTEKMXPIRPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O2.C2H4/c1-10(2)12-9-11(14-15(12)3)7-5-6-8-13(16)17-4;1-2/h9-10H,5-8H2,1-4H3;1-2H2.
What are the key properties of ethene;methyl 5-(1-methyl-5-propan-2-ylpyrazol-3-yl)pentanoate?
ethene;methyl 5-(1-methyl-5-propan-2-ylpyrazol-3-yl)pentanoate has a molecular weight of 266.38 g/mol, XLogP of 3.23, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;methyl 5-(1-methyl-5-propan-2-ylpyrazol-3-yl)pentanoate is sourced from PubChem (CID 154683252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).