C13H19F3N2O2 — CID 168907715
ethyl 2-methyl-3-[1-propan-2-yl-3-(trifluoromethyl)pyrazol-5-yl]propanoate (PubChem CID 168907715) has the molecular formula C13H19F3N2O2 and a molecular weight of 292.30 g/mol. Its IUPAC name is ethyl 2-methyl-3-[1-propan-2-yl-3-(trifluoromethyl)pyrazol-5-yl]propanoate.
| Compound Name | ethyl 2-methyl-3-[1-propan-2-yl-3-(trifluoromethyl)pyrazol-5-yl]propanoate |
|---|---|
| PubChem CID | 168907715 |
| Molecular Formula | C13H19F3N2O2 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | ethyl 2-methyl-3-[1-propan-2-yl-3-(trifluoromethyl)pyrazol-5-yl]propanoate |
| SMILES | CCOC(=O)C(C)Cc1cc(C(F)(F)F)nn1C(C)C |
| InChI | InChI=1S/C13H19F3N2O2/c1-5-20-12(19)9(4)6-10-7-11(13(14,15)16)17-18(10)8(2)3/h7-9H,5-6H2,1-4H3 |
| InChIKey | XOQCCROHTBYKRZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |