C14H18F3N3O6 — CID 154617983
diethyl 2-[(1R)-1-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-2-nitroethyl]propanedioate (PubChem CID 154617983) has the molecular formula C14H18F3N3O6 and a molecular weight of 381.31 g/mol. Its IUPAC name is diethyl 2-[(1R)-1-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-2-nitroethyl]propanedioate.
| Compound Name | diethyl 2-[(1R)-1-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-2-nitroethyl]propanedioate |
|---|---|
| PubChem CID | 154617983 |
| Molecular Formula | C14H18F3N3O6 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | diethyl 2-[(1R)-1-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-2-nitroethyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@H](C[N+](=O)[O-])c1cc(C(F)(F)F)n(C)n1 |
| InChI | InChI=1S/C14H18F3N3O6/c1-4-25-12(21)11(13(22)26-5-2)8(7-20(23)24)9-6-10(14(15,16)17)19(3)18-9/h6,8,11H,4-5,7H2,1-3H3/t8-/m1/s1 |
| InChIKey | HYPWENYFGHTUTE-MRVPVSSYSA-N |
| XLogP | 1.54 |
| TPSA | 113.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|