C13H20FN3O6 — CID 154618000
diethyl 2-[(1R)-2-(dihydroxyamino)-1-(5-fluoro-1-methylpyrazol-3-yl)ethyl]propanedioate (PubChem CID 154618000) has the molecular formula C13H20FN3O6 and a molecular weight of 333.32 g/mol. Its IUPAC name is diethyl 2-[(1R)-2-(dihydroxyamino)-1-(5-fluoro-1-methylpyrazol-3-yl)ethyl]propanedioate.
| Compound Name | diethyl 2-[(1R)-2-(dihydroxyamino)-1-(5-fluoro-1-methylpyrazol-3-yl)ethyl]propanedioate |
|---|---|
| PubChem CID | 154618000 |
| Molecular Formula | C13H20FN3O6 |
| Molecular Weight | 333.32 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | diethyl 2-[(1R)-2-(dihydroxyamino)-1-(5-fluoro-1-methylpyrazol-3-yl)ethyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@H](CN(O)O)c1cc(F)n(C)n1 |
| InChI | InChI=1S/C13H20FN3O6/c1-4-22-12(18)11(13(19)23-5-2)8(7-17(20)21)9-6-10(14)16(3)15-9/h6,8,11,20-21H,4-5,7H2,1-3H3/t8-/m1/s1 |
| InChIKey | TXTUWSGJXJUDPI-MRVPVSSYSA-N |
| XLogP | 0.47 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.32 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|