C14H20F3N3O6 — CID 155024464
diethyl 2-[2-(dihydroxyamino)-1-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]ethyl]propanedioate (PubChem CID 155024464) has the molecular formula C14H20F3N3O6 and a molecular weight of 383.32 g/mol. Its IUPAC name is diethyl 2-[2-(dihydroxyamino)-1-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]ethyl]propanedioate.
| Compound Name | diethyl 2-[2-(dihydroxyamino)-1-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]ethyl]propanedioate |
|---|---|
| PubChem CID | 155024464 |
| Molecular Formula | C14H20F3N3O6 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | diethyl 2-[2-(dihydroxyamino)-1-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]ethyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(CN(O)O)c1cc(C(F)(F)F)n(C)n1 |
| InChI | InChI=1S/C14H20F3N3O6/c1-4-25-12(21)11(13(22)26-5-2)8(7-20(23)24)9-6-10(14(15,16)17)19(3)18-9/h6,8,11,23-24H,4-5,7H2,1-3H3 |
| InChIKey | PAUVVSQKZHRMSD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|