C12H18FN3O4 — CID 154618004
ethyl (3R)-2-ethyl-3-(5-fluoro-1-methylpyrazol-3-yl)-4-nitrobutanoate (PubChem CID 154618004) has the molecular formula C12H18FN3O4 and a molecular weight of 287.29 g/mol. Its IUPAC name is ethyl (3R)-2-ethyl-3-(5-fluoro-1-methylpyrazol-3-yl)-4-nitrobutanoate.
| Compound Name | ethyl (3R)-2-ethyl-3-(5-fluoro-1-methylpyrazol-3-yl)-4-nitrobutanoate |
|---|---|
| PubChem CID | 154618004 |
| Molecular Formula | C12H18FN3O4 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | ethyl (3R)-2-ethyl-3-(5-fluoro-1-methylpyrazol-3-yl)-4-nitrobutanoate |
| SMILES | CCOC(=O)C(CC)[C@H](C[N+](=O)[O-])c1cc(F)n(C)n1 |
| InChI | InChI=1S/C12H18FN3O4/c1-4-8(12(17)20-5-2)9(7-16(18)19)10-6-11(13)15(3)14-10/h6,8-9H,4-5,7H2,1-3H3/t8?,9-/m0/s1 |
| InChIKey | FFIWJFFWVWNEKI-GKAPJAKFSA-N |
| XLogP | 1.51 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|