C13H18F3N3O4 — CID 155612908
ethyl (3S)-2-ethyl-3-[1-methyl-5-(trifluoromethyl)pyrazol-4-yl]-4-nitrobutanoate (PubChem CID 155612908) has the molecular formula C13H18F3N3O4 and a molecular weight of 337.30 g/mol. Its IUPAC name is ethyl (3S)-2-ethyl-3-[1-methyl-5-(trifluoromethyl)pyrazol-4-yl]-4-nitrobutanoate.
| Compound Name | ethyl (3S)-2-ethyl-3-[1-methyl-5-(trifluoromethyl)pyrazol-4-yl]-4-nitrobutanoate |
|---|---|
| PubChem CID | 155612908 |
| Molecular Formula | C13H18F3N3O4 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | ethyl (3S)-2-ethyl-3-[1-methyl-5-(trifluoromethyl)pyrazol-4-yl]-4-nitrobutanoate |
| SMILES | CCOC(=O)C(CC)[C@H](C[N+](=O)[O-])c1cnn(C)c1C(F)(F)F |
| InChI | InChI=1S/C13H18F3N3O4/c1-4-8(12(20)23-5-2)10(7-19(21)22)9-6-17-18(3)11(9)13(14,15)16/h6,8,10H,4-5,7H2,1-3H3/t8?,10-/m0/s1 |
| InChIKey | AJKMHRGZGBIMRE-HTLJXXAVSA-N |
| XLogP | 2.39 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|