C13H20FN3O4 — CID 174336270
ethyl 2-[(1R)-1-(5-fluoro-1-methylpyrazol-3-yl)-2-nitroethyl]pentanoate (PubChem CID 174336270) has the molecular formula C13H20FN3O4 and a molecular weight of 301.32 g/mol. Its IUPAC name is ethyl 2-[(1R)-1-(5-fluoro-1-methylpyrazol-3-yl)-2-nitroethyl]pentanoate.
| Compound Name | ethyl 2-[(1R)-1-(5-fluoro-1-methylpyrazol-3-yl)-2-nitroethyl]pentanoate |
|---|---|
| PubChem CID | 174336270 |
| Molecular Formula | C13H20FN3O4 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | ethyl 2-[(1R)-1-(5-fluoro-1-methylpyrazol-3-yl)-2-nitroethyl]pentanoate |
| SMILES | CCCC(C(=O)OCC)[C@H](C[N+](=O)[O-])c1cc(F)n(C)n1 |
| InChI | InChI=1S/C13H20FN3O4/c1-4-6-9(13(18)21-5-2)10(8-17(19)20)11-7-12(14)16(3)15-11/h7,9-10H,4-6,8H2,1-3H3/t9?,10-/m0/s1 |
| InChIKey | ZWYMBNPXSBFLGF-AXDSSHIGSA-N |
| XLogP | 1.90 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|