C12H18F2N2O2 — CID 166977224
methyl 5-[5-(1,1-difluoroethyl)-1-methylpyrazol-3-yl]pentanoate (PubChem CID 166977224) has the molecular formula C12H18F2N2O2 and a molecular weight of 260.28 g/mol. Its IUPAC name is methyl 5-[5-(1,1-difluoroethyl)-1-methylpyrazol-3-yl]pentanoate.
| Compound Name | methyl 5-[5-(1,1-difluoroethyl)-1-methylpyrazol-3-yl]pentanoate |
|---|---|
| PubChem CID | 166977224 |
| Molecular Formula | C12H18F2N2O2 |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | methyl 5-[5-(1,1-difluoroethyl)-1-methylpyrazol-3-yl]pentanoate |
| SMILES | COC(=O)CCCCc1cc(C(C)(F)F)n(C)n1 |
| InChI | InChI=1S/C12H18F2N2O2/c1-12(13,14)10-8-9(15-16(10)2)6-4-5-7-11(17)18-3/h8H,4-7H2,1-3H3 |
| InChIKey | XRHKKGFRKCPJCP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|