C22H26N6O2 — CID 130468698
(1R)-2-[4-(3,6-dihydro-2H-pyran-4-yl)-3,5-dimethylpyrazol-1-yl]-1-[(5-pyrazin-2-yl-2-pyridinyl)amino]propan-1-ol (PubChem CID 130468698) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is (1R)-2-[4-(3,6-dihydro-2H-pyran-4-yl)-3,5-dimethylpyrazol-1-yl]-1-[(5-pyrazin-2-yl-2-pyridinyl)amino]propan-1-ol.
| Compound Name | (1R)-2-[4-(3,6-dihydro-2H-pyran-4-yl)-3,5-dimethylpyrazol-1-yl]-1-[(5-pyrazin-2-yl-2-pyridinyl)amino]propan-1-ol |
|---|---|
| PubChem CID | 130468698 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | (1R)-2-[4-(3,6-dihydro-2H-pyran-4-yl)-3,5-dimethylpyrazol-1-yl]-1-[(5-pyrazin-2-yl-2-pyridinyl)amino]propan-1-ol |
| SMILES | Cc1nn(C(C)[C@@H](O)Nc2ccc(-c3cnccn3)cn2)c(C)c1C1=CCOCC1 |
| InChI | InChI=1S/C22H26N6O2/c1-14-21(17-6-10-30-11-7-17)15(2)28(27-14)16(3)22(29)26-20-5-4-18(12-25-20)19-13-23-8-9-24-19/h4-6,8-9,12-13,16,22,29H,7,10-11H2,1-3H3,(H,25,26)/t16?,22-/m1/s1 |
| InChIKey | IWMFXGADZNIXHK-VXNXSFHZSA-N |
| XLogP | 3.15 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|