C24H30N4O2 — CID 130470894
1-[4-(4-butyl-1H-diazet-2-yl)phenyl]-3-[2-methyl-5-(3-oxobutyl)phenyl]urea (PubChem CID 130470894) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 1-[4-(4-butyl-1H-diazet-2-yl)phenyl]-3-[2-methyl-5-(3-oxobutyl)phenyl]urea.
| Compound Name | 1-[4-(4-butyl-1H-diazet-2-yl)phenyl]-3-[2-methyl-5-(3-oxobutyl)phenyl]urea |
|---|---|
| PubChem CID | 130470894 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 1-[4-(4-butyl-1H-diazet-2-yl)phenyl]-3-[2-methyl-5-(3-oxobutyl)phenyl]urea |
| SMILES | CCCCc1cn(-c2ccc(NC(=O)Nc3cc(CCC(C)=O)ccc3C)cc2)[nH]1 |
| InChI | InChI=1S/C24H30N4O2/c1-4-5-6-21-16-28(27-21)22-13-11-20(12-14-22)25-24(30)26-23-15-19(9-7-17(23)2)10-8-18(3)29/h7,9,11-16,27H,4-6,8,10H2,1-3H3,(H2,25,26,30) |
| InChIKey | YCQOXMSFHBDRNO-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |