C16H12F4N4O — CID 130472987
N-(cyanomethyl)-N-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]propanamide (PubChem CID 130472987) has the molecular formula C16H12F4N4O and a molecular weight of 352.29 g/mol. Its IUPAC name is N-(cyanomethyl)-N-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]propanamide.
| Compound Name | N-(cyanomethyl)-N-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]propanamide |
|---|---|
| PubChem CID | 130472987 |
| Molecular Formula | C16H12F4N4O |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | N-(cyanomethyl)-N-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]propanamide |
| SMILES | CCC(=O)N(CC#N)c1ccc(-c2cncc(F)c2)nc1C(F)(F)F |
| InChI | InChI=1S/C16H12F4N4O/c1-2-14(25)24(6-5-21)13-4-3-12(23-15(13)16(18,19)20)10-7-11(17)9-22-8-10/h3-4,7-9H,2,6H2,1H3 |
| InChIKey | UAWYKADQLSNRAY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|