C26H31NO2S — CID 130473753
2-benzyl-5-[2-[(3E)-6-methylhepta-1,3,5-trien-3-yl]sulfonylpropan-2-yl]-1,3-dihydroisoindole (PubChem CID 130473753) has the molecular formula C26H31NO2S and a molecular weight of 421.61 g/mol. Its IUPAC name is 2-benzyl-5-[2-[(3E)-6-methylhepta-1,3,5-trien-3-yl]sulfonylpropan-2-yl]-1,3-dihydroisoindole.
| Compound Name | 2-benzyl-5-[2-[(3E)-6-methylhepta-1,3,5-trien-3-yl]sulfonylpropan-2-yl]-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 130473753 |
| Molecular Formula | C26H31NO2S |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 2-benzyl-5-[2-[(3E)-6-methylhepta-1,3,5-trien-3-yl]sulfonylpropan-2-yl]-1,3-dihydroisoindole |
| SMILES | C=C/C(=C\C=C(C)C)S(=O)(=O)C(C)(C)c1ccc2c(c1)CN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C26H31NO2S/c1-6-25(15-12-20(2)3)30(28,29)26(4,5)24-14-13-22-18-27(19-23(22)16-24)17-21-10-8-7-9-11-21/h6-16H,1,17-19H2,2-5H3/b25-15+ |
| InChIKey | WLQQZAPCSCUTHS-MFKUBSTISA-N |
| XLogP | 5.89 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|