C26H38N2O3 — CID 130473932
(2S,6'S,7'S,8'aS)-6'-ethyl-4-methoxy-7'-[(E)-1-methoxy-3,3-dimethylpent-1-en-2-yl]spiro[1H-indole-2,1'-3,5,6,7,8,8a-hexahydro-2H-indolizine]-3-one (PubChem CID 130473932) has the molecular formula C26H38N2O3 and a molecular weight of 426.60 g/mol. Its IUPAC name is (2S,6'S,7'S,8'aS)-6'-ethyl-4-methoxy-7'-[(E)-1-methoxy-3,3-dimethylpent-1-en-2-yl]spiro[1H-indole-2,1'-3,5,6,7,8,8a-hexahydro-2H-indolizine]-3-one.
| Compound Name | (2S,6'S,7'S,8'aS)-6'-ethyl-4-methoxy-7'-[(E)-1-methoxy-3,3-dimethylpent-1-en-2-yl]spiro[1H-indole-2,1'-3,5,6,7,8,8a-hexahydro-2H-indolizine]-3-one |
|---|---|
| PubChem CID | 130473932 |
| Molecular Formula | C26H38N2O3 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.29 |
| IUPAC Name | (2S,6'S,7'S,8'aS)-6'-ethyl-4-methoxy-7'-[(E)-1-methoxy-3,3-dimethylpent-1-en-2-yl]spiro[1H-indole-2,1'-3,5,6,7,8,8a-hexahydro-2H-indolizine]-3-one |
| SMILES | CC[C@@H]1CN2CC[C@]3(Nc4cccc(OC)c4C3=O)[C@@H]2C[C@@H]1/C(=C\OC)C(C)(C)CC |
| InChI | InChI=1S/C26H38N2O3/c1-7-17-15-28-13-12-26(24(29)23-20(27-26)10-9-11-21(23)31-6)22(28)14-18(17)19(16-30-5)25(3,4)8-2/h9-11,16-18,22,27H,7-8,12-15H2,1-6H3/b19-16+/t17-,18+,22+,26+/m1/s1 |
| InChIKey | TUTWIJIANMKIKO-GWPDELCMSA-N |
| XLogP | 5.13 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|