C31H37FN2O4 — CID 178142621
methyl (E)-2-[(2S,6'S,7'S,8'aS)-6'-ethyl-4-[3-(4-fluorophenyl)propyl]-3-oxospiro[1H-indole-2,1'-3,5,6,7,8,8a-hexahydro-2H-indolizine]-7'-yl]-3-methoxyprop-2-enoate (PubChem CID 178142621) has the molecular formula C31H37FN2O4 and a molecular weight of 520.65 g/mol. Its IUPAC name is methyl (E)-2-[(2S,6'S,7'S,8'aS)-6'-ethyl-4-[3-(4-fluorophenyl)propyl]-3-oxospiro[1H-indole-2,1'-3,5,6,7,8,8a-hexahydro-2H-indolizine]-7'-yl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[(2S,6'S,7'S,8'aS)-6'-ethyl-4-[3-(4-fluorophenyl)propyl]-3-oxospiro[1H-indole-2,1'-3,5,6,7,8,8a-hexahydro-2H-indolizine]-7'-yl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 178142621 |
| Molecular Formula | C31H37FN2O4 |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | methyl (E)-2-[(2S,6'S,7'S,8'aS)-6'-ethyl-4-[3-(4-fluorophenyl)propyl]-3-oxospiro[1H-indole-2,1'-3,5,6,7,8,8a-hexahydro-2H-indolizine]-7'-yl]-3-methoxyprop-2-enoate |
| SMILES | CC[C@@H]1CN2CC[C@]3(Nc4cccc(CCCc5ccc(F)cc5)c4C3=O)[C@@H]2C[C@@H]1/C(=C\OC)C(=O)OC |
| InChI | InChI=1S/C31H37FN2O4/c1-4-21-18-34-16-15-31(27(34)17-24(21)25(19-37-2)30(36)38-3)29(35)28-22(9-6-10-26(28)33-31)8-5-7-20-11-13-23(32)14-12-20/h6,9-14,19,21,24,27,33H,4-5,7-8,15-18H2,1-3H3/b25-19+/t21-,24+,27+,31+/m1/s1 |
| InChIKey | KKIKOYNIVLZKNW-LWIVBGRFSA-N |
| XLogP | 5.17 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|