C30H36N2O5 — CID 178142604
methyl (E)-2-[(2S,6'S,7'S,8'aS)-6'-ethyl-3-oxo-4-(2-phenylethoxy)spiro[1H-indole-2,1'-3,5,6,7,8,8a-hexahydro-2H-indolizine]-7'-yl]-3-methoxyprop-2-enoate (PubChem CID 178142604) has the molecular formula C30H36N2O5 and a molecular weight of 504.63 g/mol. Its IUPAC name is methyl (E)-2-[(2S,6'S,7'S,8'aS)-6'-ethyl-3-oxo-4-(2-phenylethoxy)spiro[1H-indole-2,1'-3,5,6,7,8,8a-hexahydro-2H-indolizine]-7'-yl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[(2S,6'S,7'S,8'aS)-6'-ethyl-3-oxo-4-(2-phenylethoxy)spiro[1H-indole-2,1'-3,5,6,7,8,8a-hexahydro-2H-indolizine]-7'-yl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 178142604 |
| Molecular Formula | C30H36N2O5 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | methyl (E)-2-[(2S,6'S,7'S,8'aS)-6'-ethyl-3-oxo-4-(2-phenylethoxy)spiro[1H-indole-2,1'-3,5,6,7,8,8a-hexahydro-2H-indolizine]-7'-yl]-3-methoxyprop-2-enoate |
| SMILES | CC[C@@H]1CN2CC[C@]3(Nc4cccc(OCCc5ccccc5)c4C3=O)[C@@H]2C[C@@H]1/C(=C\OC)C(=O)OC |
| InChI | InChI=1S/C30H36N2O5/c1-4-21-18-32-15-14-30(26(32)17-22(21)23(19-35-2)29(34)36-3)28(33)27-24(31-30)11-8-12-25(27)37-16-13-20-9-6-5-7-10-20/h5-12,19,21-22,26,31H,4,13-18H2,1-3H3/b23-19+/t21-,22+,26+,30+/m1/s1 |
| InChIKey | AWMYIXUGYYGJBJ-PAKGBSETSA-N |
| XLogP | 4.48 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|