C41H50N2O6 — CID 121367726
methyl (E)-2-[(1R,6R,7S,8aS)-6-ethyl-2'-oxo-1'-[6-(4-phenylmethoxyphenoxy)hexyl]spiro[3,5,6,7,8,8a-hexahydro-2H-indolizine-1,3'-indole]-7-yl]-3-methoxyprop-2-enoate (PubChem CID 121367726) has the molecular formula C41H50N2O6 and a molecular weight of 666.86 g/mol. Its IUPAC name is methyl (E)-2-[(1R,6R,7S,8aS)-6-ethyl-2'-oxo-1'-[6-(4-phenylmethoxyphenoxy)hexyl]spiro[3,5,6,7,8,8a-hexahydro-2H-indolizine-1,3'-indole]-7-yl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[(1R,6R,7S,8aS)-6-ethyl-2'-oxo-1'-[6-(4-phenylmethoxyphenoxy)hexyl]spiro[3,5,6,7,8,8a-hexahydro-2H-indolizine-1,3'-indole]-7-yl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 121367726 |
| Molecular Formula | C41H50N2O6 |
| Molecular Weight | 666.86 g/mol |
| Exact Mass | 666.37 |
| IUPAC Name | methyl (E)-2-[(1R,6R,7S,8aS)-6-ethyl-2'-oxo-1'-[6-(4-phenylmethoxyphenoxy)hexyl]spiro[3,5,6,7,8,8a-hexahydro-2H-indolizine-1,3'-indole]-7-yl]-3-methoxyprop-2-enoate |
| SMILES | CC[C@H]1CN2CC[C@]3(C(=O)N(CCCCCCOc4ccc(OCc5ccccc5)cc4)c4ccccc43)[C@@H]2C[C@@H]1/C(=C\OC)C(=O)OC |
| InChI | InChI=1S/C41H50N2O6/c1-4-31-27-42-24-22-41(38(42)26-34(31)35(29-46-2)39(44)47-3)36-16-10-11-17-37(36)43(40(41)45)23-12-5-6-13-25-48-32-18-20-33(21-19-32)49-28-30-14-8-7-9-15-30/h7-11,14-21,29,31,34,38H,4-6,12-13,22-28H2,1-3H3/b35-29+/t31-,34-,38-,41+/m0/s1 |
| InChIKey | RECTTXVHJHDXQR-SHNDEVMYSA-N |
| XLogP | 7.31 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.86 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|