C37H46BrIN2O6 — CID 129057723
8-[(1R,6R,7S)-7-[(E)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]-6-ethyl-2'-oxospiro[3,5,6,7,8,8a-hexahydro-2H-indolizine-1,3'-indole]-1'-yl]octyl 4-bromo-2-iodobenzoate (PubChem CID 129057723) has the molecular formula C37H46BrIN2O6 and a molecular weight of 821.59 g/mol. Its IUPAC name is 8-[(1R,6R,7S)-7-[(E)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]-6-ethyl-2'-oxospiro[3,5,6,7,8,8a-hexahydro-2H-indolizine-1,3'-indole]-1'-yl]octyl 4-bromo-2-iodobenzoate.
| Compound Name | 8-[(1R,6R,7S)-7-[(E)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]-6-ethyl-2'-oxospiro[3,5,6,7,8,8a-hexahydro-2H-indolizine-1,3'-indole]-1'-yl]octyl 4-bromo-2-iodobenzoate |
|---|---|
| PubChem CID | 129057723 |
| Molecular Formula | C37H46BrIN2O6 |
| Molecular Weight | 821.59 g/mol |
| Exact Mass | 820.16 |
| IUPAC Name | 8-[(1R,6R,7S)-7-[(E)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]-6-ethyl-2'-oxospiro[3,5,6,7,8,8a-hexahydro-2H-indolizine-1,3'-indole]-1'-yl]octyl 4-bromo-2-iodobenzoate |
| SMILES | CC[C@H]1CN2CC[C@]3(C(=O)N(CCCCCCCCOC(=O)c4ccc(Br)cc4I)c4ccccc43)C2C[C@@H]1/C(=C\OC)C(=O)OC |
| InChI | InChI=1S/C37H46BrIN2O6/c1-4-25-23-40-19-17-37(33(40)22-28(25)29(24-45-2)34(42)46-3)30-13-9-10-14-32(30)41(36(37)44)18-11-7-5-6-8-12-20-47-35(43)27-16-15-26(38)21-31(27)39/h9-10,13-16,21,24-25,28,33H,4-8,11-12,17-20,22-23H2,1-3H3/b29-24+/t25-,28-,33?,37+/m0/s1 |
| InChIKey | YJTYTGPNASJVOV-FIRYLLFUSA-N |
| XLogP | 7.66 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.59 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|