C22H28N2O4 — CID 153281479
methyl (E)-2-[(6'S,7'R)-6'-ethyl-2-oxospiro[1H-indole-3,1'-3,5,6,7,8,8a-hexahydro-2H-indolizine]-7'-yl]-4-hydroxybut-2-enoate (PubChem CID 153281479) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is methyl (E)-2-[(6'S,7'R)-6'-ethyl-2-oxospiro[1H-indole-3,1'-3,5,6,7,8,8a-hexahydro-2H-indolizine]-7'-yl]-4-hydroxybut-2-enoate.
| Compound Name | methyl (E)-2-[(6'S,7'R)-6'-ethyl-2-oxospiro[1H-indole-3,1'-3,5,6,7,8,8a-hexahydro-2H-indolizine]-7'-yl]-4-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 153281479 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | methyl (E)-2-[(6'S,7'R)-6'-ethyl-2-oxospiro[1H-indole-3,1'-3,5,6,7,8,8a-hexahydro-2H-indolizine]-7'-yl]-4-hydroxybut-2-enoate |
| SMILES | CC[C@@H]1CN2CCC3(C(=O)Nc4ccccc43)C2C[C@H]1/C(=C\CO)C(=O)OC |
| InChI | InChI=1S/C22H28N2O4/c1-3-14-13-24-10-9-22(17-6-4-5-7-18(17)23-21(22)27)19(24)12-16(14)15(8-11-25)20(26)28-2/h4-8,14,16,19,25H,3,9-13H2,1-2H3,(H,23,27)/b15-8+/t14-,16-,19?,22?/m1/s1 |
| InChIKey | KUGFTVOVTILRDE-ISBWFAHQSA-N |
| XLogP | 2.09 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|