C30H36N2O5 — CID 129065330
methyl (E)-2-[(1R,6R,7S)-6-ethyl-1'-[(3-methoxyphenyl)methyl]-2'-oxospiro[3,5,6,7,8,8a-hexahydro-2H-indolizine-1,3'-indole]-7-yl]-3-methoxyprop-2-enoate (PubChem CID 129065330) has the molecular formula C30H36N2O5 and a molecular weight of 504.63 g/mol. Its IUPAC name is methyl (E)-2-[(1R,6R,7S)-6-ethyl-1'-[(3-methoxyphenyl)methyl]-2'-oxospiro[3,5,6,7,8,8a-hexahydro-2H-indolizine-1,3'-indole]-7-yl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[(1R,6R,7S)-6-ethyl-1'-[(3-methoxyphenyl)methyl]-2'-oxospiro[3,5,6,7,8,8a-hexahydro-2H-indolizine-1,3'-indole]-7-yl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 129065330 |
| Molecular Formula | C30H36N2O5 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | methyl (E)-2-[(1R,6R,7S)-6-ethyl-1'-[(3-methoxyphenyl)methyl]-2'-oxospiro[3,5,6,7,8,8a-hexahydro-2H-indolizine-1,3'-indole]-7-yl]-3-methoxyprop-2-enoate |
| SMILES | CC[C@H]1CN2CC[C@]3(C(=O)N(Cc4cccc(OC)c4)c4ccccc43)C2C[C@@H]1/C(=C\OC)C(=O)OC |
| InChI | InChI=1S/C30H36N2O5/c1-5-21-18-31-14-13-30(27(31)16-23(21)24(19-35-2)28(33)37-4)25-11-6-7-12-26(25)32(29(30)34)17-20-9-8-10-22(15-20)36-3/h6-12,15,19,21,23,27H,5,13-14,16-18H2,1-4H3/b24-19+/t21-,23-,27?,30+/m0/s1 |
| InChIKey | WJROUUVYQVEEOB-MMUQUFRESA-N |
| XLogP | 4.30 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|