C43H54N2O6 — CID 129057720
methyl (E)-2-[(1R,6R,7S)-6-ethyl-2'-oxo-1'-[8-(4-phenylmethoxyphenoxy)octyl]spiro[3,5,6,7,8,8a-hexahydro-2H-indolizine-1,3'-indole]-7-yl]-3-methoxyprop-2-enoate (PubChem CID 129057720) has the molecular formula C43H54N2O6 and a molecular weight of 694.91 g/mol. Its IUPAC name is methyl (E)-2-[(1R,6R,7S)-6-ethyl-2'-oxo-1'-[8-(4-phenylmethoxyphenoxy)octyl]spiro[3,5,6,7,8,8a-hexahydro-2H-indolizine-1,3'-indole]-7-yl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[(1R,6R,7S)-6-ethyl-2'-oxo-1'-[8-(4-phenylmethoxyphenoxy)octyl]spiro[3,5,6,7,8,8a-hexahydro-2H-indolizine-1,3'-indole]-7-yl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 129057720 |
| Molecular Formula | C43H54N2O6 |
| Molecular Weight | 694.91 g/mol |
| Exact Mass | 694.40 |
| IUPAC Name | methyl (E)-2-[(1R,6R,7S)-6-ethyl-2'-oxo-1'-[8-(4-phenylmethoxyphenoxy)octyl]spiro[3,5,6,7,8,8a-hexahydro-2H-indolizine-1,3'-indole]-7-yl]-3-methoxyprop-2-enoate |
| SMILES | CC[C@H]1CN2CC[C@]3(C(=O)N(CCCCCCCCOc4ccc(OCc5ccccc5)cc4)c4ccccc43)C2C[C@@H]1/C(=C\OC)C(=O)OC |
| InChI | InChI=1S/C43H54N2O6/c1-4-33-29-44-26-24-43(40(44)28-36(33)37(31-48-2)41(46)49-3)38-18-12-13-19-39(38)45(42(43)47)25-14-7-5-6-8-15-27-50-34-20-22-35(23-21-34)51-30-32-16-10-9-11-17-32/h9-13,16-23,31,33,36,40H,4-8,14-15,24-30H2,1-3H3/b37-31+/t33-,36-,40?,43+/m0/s1 |
| InChIKey | RZIOSGAMBQQKJW-BEKYXQKBSA-N |
| XLogP | 8.09 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.91 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|