C23H29BrN2O5 — CID 146389233
methyl (E)-2-[(7aS)-10-bromo-3-ethyl-7a-hydroxy-8-methoxy-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate (PubChem CID 146389233) has the molecular formula C23H29BrN2O5 and a molecular weight of 493.40 g/mol. Its IUPAC name is methyl (E)-2-[(7aS)-10-bromo-3-ethyl-7a-hydroxy-8-methoxy-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[(7aS)-10-bromo-3-ethyl-7a-hydroxy-8-methoxy-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 146389233 |
| Molecular Formula | C23H29BrN2O5 |
| Molecular Weight | 493.40 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | methyl (E)-2-[(7aS)-10-bromo-3-ethyl-7a-hydroxy-8-methoxy-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate |
| SMILES | CCC1CN2CC[C@@]3(O)C(=Nc4cc(Br)cc(OC)c43)C2CC1/C(=C\OC)C(=O)OC |
| InChI | InChI=1S/C23H29BrN2O5/c1-5-13-11-26-7-6-23(28)20-17(8-14(24)9-19(20)30-3)25-21(23)18(26)10-15(13)16(12-29-2)22(27)31-4/h8-9,12-13,15,18,28H,5-7,10-11H2,1-4H3/b16-12+/t13?,15?,18?,23-/m0/s1 |
| InChIKey | MVBDBOFMTGZTDV-XESHUUNJSA-N |
| XLogP | 3.56 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|