C24H32N2O5 — CID 145374798
methyl (E)-2-[(11S)-6-ethyl-11-hydroxy-13-methoxy-8,18-diazatetracyclo[9.7.0.02,8.012,17]octadeca-1(18),12(17),13,15-tetraen-5-yl]-3-methoxyprop-2-enoate (PubChem CID 145374798) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is methyl (E)-2-[(11S)-6-ethyl-11-hydroxy-13-methoxy-8,18-diazatetracyclo[9.7.0.02,8.012,17]octadeca-1(18),12(17),13,15-tetraen-5-yl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[(11S)-6-ethyl-11-hydroxy-13-methoxy-8,18-diazatetracyclo[9.7.0.02,8.012,17]octadeca-1(18),12(17),13,15-tetraen-5-yl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 145374798 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | methyl (E)-2-[(11S)-6-ethyl-11-hydroxy-13-methoxy-8,18-diazatetracyclo[9.7.0.02,8.012,17]octadeca-1(18),12(17),13,15-tetraen-5-yl]-3-methoxyprop-2-enoate |
| SMILES | CCC1CN2CC[C@@]3(O)C(=Nc4cccc(OC)c43)C2CCC1/C(=C\OC)C(=O)OC |
| InChI | InChI=1S/C24H32N2O5/c1-5-15-13-26-12-11-24(28)21-18(7-6-8-20(21)30-3)25-22(24)19(26)10-9-16(15)17(14-29-2)23(27)31-4/h6-8,14-16,19,28H,5,9-13H2,1-4H3/b17-14+/t15?,16?,19?,24-/m0/s1 |
| InChIKey | DMOAZGZJEHRMQP-MCWJCYKBSA-N |
| XLogP | 3.18 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|