C21H19F5N2O2 — CID 130474065
N-[1-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]-2-methylpropyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 130474065) has the molecular formula C21H19F5N2O2 and a molecular weight of 426.39 g/mol. Its IUPAC name is N-[1-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]-2-methylpropyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[1-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]-2-methylpropyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 130474065 |
| Molecular Formula | C21H19F5N2O2 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | N-[1-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]-2-methylpropyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | CC(C)C(NC(=O)c1c(F)c(F)c(F)c(F)c1F)C1=N[C@@H](Cc2ccccc2)CO1 |
| InChI | InChI=1S/C21H19F5N2O2/c1-10(2)19(21-27-12(9-30-21)8-11-6-4-3-5-7-11)28-20(29)13-14(22)16(24)18(26)17(25)15(13)23/h3-7,10,12,19H,8-9H2,1-2H3,(H,28,29)/t12-,19?/m0/s1 |
| InChIKey | NAAXZUOQXCHTJM-HSLMYDHPSA-N |
| XLogP | 4.18 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|