C17H20INO3S — CID 130474358
N-(5-iodo-4-methoxy-2-propan-2-ylphenyl)-4-methylbenzenesulfonamide (PubChem CID 130474358) has the molecular formula C17H20INO3S and a molecular weight of 445.32 g/mol. Its IUPAC name is N-(5-iodo-4-methoxy-2-propan-2-ylphenyl)-4-methylbenzenesulfonamide.
| Compound Name | N-(5-iodo-4-methoxy-2-propan-2-ylphenyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 130474358 |
| Molecular Formula | C17H20INO3S |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | N-(5-iodo-4-methoxy-2-propan-2-ylphenyl)-4-methylbenzenesulfonamide |
| SMILES | COc1cc(C(C)C)c(NS(=O)(=O)c2ccc(C)cc2)cc1I |
| InChI | InChI=1S/C17H20INO3S/c1-11(2)14-9-17(22-4)15(18)10-16(14)19-23(20,21)13-7-5-12(3)6-8-13/h5-11,19H,1-4H3 |
| InChIKey | DXCNWBCAKIPZIX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|