C34H39IO8S2 — CID 157179404
(5-iodo-4-methoxy-2-propan-2-ylphenyl) 4-methylbenzenesulfonate;(4-methoxy-2-propan-2-ylphenyl) 4-methylbenzenesulfonate (PubChem CID 157179404) has the molecular formula C34H39IO8S2 and a molecular weight of 766.72 g/mol. Its IUPAC name is (5-iodo-4-methoxy-2-propan-2-ylphenyl) 4-methylbenzenesulfonate;(4-methoxy-2-propan-2-ylphenyl) 4-methylbenzenesulfonate.
| Compound Name | (5-iodo-4-methoxy-2-propan-2-ylphenyl) 4-methylbenzenesulfonate;(4-methoxy-2-propan-2-ylphenyl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 157179404 |
| Molecular Formula | C34H39IO8S2 |
| Molecular Weight | 766.72 g/mol |
| Exact Mass | 766.11 |
| IUPAC Name | (5-iodo-4-methoxy-2-propan-2-ylphenyl) 4-methylbenzenesulfonate;(4-methoxy-2-propan-2-ylphenyl) 4-methylbenzenesulfonate |
| SMILES | COc1cc(C(C)C)c(OS(=O)(=O)c2ccc(C)cc2)cc1I.COc1ccc(OS(=O)(=O)c2ccc(C)cc2)c(C(C)C)c1 |
| InChI | InChI=1S/C17H19IO4S.C17H20O4S/c1-11(2)14-9-17(21-4)15(18)10-16(14)22-23(19,20)13-7-5-12(3)6-8-13;1-12(2)16-11-14(20-4)7-10-17(16)21-22(18,19)15-8-5-13(3)6-9-15/h5-11H,1-4H3;5-12H,1-4H3 |
| InChIKey | AOJVUSVIHZOFFW-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.72 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|