C9H17N3 — CID 130477356
N,1-di(propan-2-yl)pyrazol-3-amine (PubChem CID 130477356) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is N,1-di(propan-2-yl)pyrazol-3-amine.
| Compound Name | N,1-di(propan-2-yl)pyrazol-3-amine |
|---|---|
| PubChem CID | 130477356 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | N,1-di(propan-2-yl)pyrazol-3-amine |
| SMILES | CC(C)Nc1ccn(C(C)C)n1 |
| InChI | InChI=1S/C9H17N3/c1-7(2)10-9-5-6-12(11-9)8(3)4/h5-8H,1-4H3,(H,10,11) |
| InChIKey | AODJMYOBVPHNDP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |