C11H23N3 — CID 169238022
N,1-di(propan-2-yl)pyrazol-3-amine;ethane (PubChem CID 169238022) has the molecular formula C11H23N3 and a molecular weight of 197.33 g/mol. Its IUPAC name is N,1-di(propan-2-yl)pyrazol-3-amine;ethane.
| Compound Name | N,1-di(propan-2-yl)pyrazol-3-amine;ethane |
|---|---|
| PubChem CID | 169238022 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | N,1-di(propan-2-yl)pyrazol-3-amine;ethane |
| SMILES | CC.CC(C)Nc1ccn(C(C)C)n1 |
| InChI | InChI=1S/C9H17N3.C2H6/c1-7(2)10-9-5-6-12(11-9)8(3)4;1-2/h5-8H,1-4H3,(H,10,11);1-2H3 |
| InChIKey | RWAGWOOKAJXLLU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |