C8H14FN3 — CID 130496244
N-(2-fluoroethyl)-1-propan-2-ylpyrazol-3-amine (PubChem CID 130496244) has the molecular formula C8H14FN3 and a molecular weight of 171.22 g/mol. Its IUPAC name is N-(2-fluoroethyl)-1-propan-2-ylpyrazol-3-amine.
| Compound Name | N-(2-fluoroethyl)-1-propan-2-ylpyrazol-3-amine |
|---|---|
| PubChem CID | 130496244 |
| Molecular Formula | C8H14FN3 |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.12 |
| IUPAC Name | N-(2-fluoroethyl)-1-propan-2-ylpyrazol-3-amine |
| SMILES | CC(C)n1ccc(NCCF)n1 |
| InChI | InChI=1S/C8H14FN3/c1-7(2)12-6-3-8(11-12)10-5-4-9/h3,6-7H,4-5H2,1-2H3,(H,10,11) |
| InChIKey | CNYFKCGSFRHXMN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |