C13H22O — CID 130478761
1-(2,2-dimethylcyclopropyl)-5,5-dimethylhex-3-yn-1-ol (PubChem CID 130478761) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is 1-(2,2-dimethylcyclopropyl)-5,5-dimethylhex-3-yn-1-ol.
| Compound Name | 1-(2,2-dimethylcyclopropyl)-5,5-dimethylhex-3-yn-1-ol |
|---|---|
| PubChem CID | 130478761 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | 1-(2,2-dimethylcyclopropyl)-5,5-dimethylhex-3-yn-1-ol |
| SMILES | CC(C)(C)C#CCC(O)C1CC1(C)C |
| InChI | InChI=1S/C13H22O/c1-12(2,3)8-6-7-11(14)10-9-13(10,4)5/h10-11,14H,7,9H2,1-5H3 |
| InChIKey | CNZDFZDENQTWLG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|