C14H20N2O — CID 13048239
1-ethyl-4-phenyl-1,5-diazocan-2-one (PubChem CID 13048239) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 1-ethyl-4-phenyl-1,5-diazocan-2-one.
| Compound Name | 1-ethyl-4-phenyl-1,5-diazocan-2-one |
|---|---|
| PubChem CID | 13048239 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 1-ethyl-4-phenyl-1,5-diazocan-2-one |
| SMILES | CCN1CCCNC(c2ccccc2)CC1=O |
| InChI | InChI=1S/C14H20N2O/c1-2-16-10-6-9-15-13(11-14(16)17)12-7-4-3-5-8-12/h3-5,7-8,13,15H,2,6,9-11H2,1H3 |
| InChIKey | KRUCZCZTXZZKLS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |