C10H18F2N2 — CID 130485140
[1-(3,3-difluorocyclopentyl)-3-methylbut-2-enyl]hydrazine (PubChem CID 130485140) has the molecular formula C10H18F2N2 and a molecular weight of 204.26 g/mol. Its IUPAC name is [1-(3,3-difluorocyclopentyl)-3-methylbut-2-enyl]hydrazine.
| Compound Name | [1-(3,3-difluorocyclopentyl)-3-methylbut-2-enyl]hydrazine |
|---|---|
| PubChem CID | 130485140 |
| Molecular Formula | C10H18F2N2 |
| Molecular Weight | 204.26 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | [1-(3,3-difluorocyclopentyl)-3-methylbut-2-enyl]hydrazine |
| SMILES | CC(C)=CC(NN)C1CCC(F)(F)C1 |
| InChI | InChI=1S/C10H18F2N2/c1-7(2)5-9(14-13)8-3-4-10(11,12)6-8/h5,8-9,14H,3-4,6,13H2,1-2H3 |
| InChIKey | OAZZVMMEYWLPSZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|