C15H31FN2 — CID 134239933
1-ethyl-2-[(E)-9-fluoro-2,4-dimethylundec-4-enyl]hydrazine (PubChem CID 134239933) has the molecular formula C15H31FN2 and a molecular weight of 258.42 g/mol. Its IUPAC name is 1-ethyl-2-[(E)-9-fluoro-2,4-dimethylundec-4-enyl]hydrazine.
| Compound Name | 1-ethyl-2-[(E)-9-fluoro-2,4-dimethylundec-4-enyl]hydrazine |
|---|---|
| PubChem CID | 134239933 |
| Molecular Formula | C15H31FN2 |
| Molecular Weight | 258.42 g/mol |
| Exact Mass | 258.25 |
| IUPAC Name | 1-ethyl-2-[(E)-9-fluoro-2,4-dimethylundec-4-enyl]hydrazine |
| SMILES | CCNNCC(C)C/C(C)=C/CCCC(F)CC |
| InChI | InChI=1S/C15H31FN2/c1-5-15(16)10-8-7-9-13(3)11-14(4)12-18-17-6-2/h9,14-15,17-18H,5-8,10-12H2,1-4H3/b13-9+ |
| InChIKey | PGTFMHDQPWRQHE-UKTHLTGXSA-N |
| XLogP | 3.99 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|