C10H12N2O2 — CID 130485797
(1,5-dimethylpyrazol-3-yl)-(furan-3-yl)methanol (PubChem CID 130485797) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is (1,5-dimethylpyrazol-3-yl)-(furan-3-yl)methanol.
| Compound Name | (1,5-dimethylpyrazol-3-yl)-(furan-3-yl)methanol |
|---|---|
| PubChem CID | 130485797 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | (1,5-dimethylpyrazol-3-yl)-(furan-3-yl)methanol |
| SMILES | Cc1cc(C(O)c2ccoc2)nn1C |
| InChI | InChI=1S/C10H12N2O2/c1-7-5-9(11-12(7)2)10(13)8-3-4-14-6-8/h3-6,10,13H,1-2H3 |
| InChIKey | TZMXRHAEQVGWSE-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |