C9H17N5 — CID 130486233
3-ethyl-N-(1-methylpyrrolidin-3-yl)triazol-4-amine (PubChem CID 130486233) has the molecular formula C9H17N5 and a molecular weight of 195.27 g/mol. Its IUPAC name is 3-ethyl-N-(1-methylpyrrolidin-3-yl)triazol-4-amine.
| Compound Name | 3-ethyl-N-(1-methylpyrrolidin-3-yl)triazol-4-amine |
|---|---|
| PubChem CID | 130486233 |
| Molecular Formula | C9H17N5 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | 3-ethyl-N-(1-methylpyrrolidin-3-yl)triazol-4-amine |
| SMILES | CCn1nncc1NC1CCN(C)C1 |
| InChI | InChI=1S/C9H17N5/c1-3-14-9(6-10-12-14)11-8-4-5-13(2)7-8/h6,8,11H,3-5,7H2,1-2H3 |
| InChIKey | UMLPEOLBTDXFNA-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |