C7H12N4S — CID 107649099
N-(1-methylpyrrolidin-3-yl)thiadiazol-5-amine (PubChem CID 107649099) has the molecular formula C7H12N4S and a molecular weight of 184.27 g/mol. Its IUPAC name is N-(1-methylpyrrolidin-3-yl)thiadiazol-5-amine.
| Compound Name | N-(1-methylpyrrolidin-3-yl)thiadiazol-5-amine |
|---|---|
| PubChem CID | 107649099 |
| Molecular Formula | C7H12N4S |
| Molecular Weight | 184.27 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | N-(1-methylpyrrolidin-3-yl)thiadiazol-5-amine |
| SMILES | CN1CCC(Nc2cnns2)C1 |
| InChI | InChI=1S/C7H12N4S/c1-11-3-2-6(5-11)9-7-4-8-10-12-7/h4,6,9H,2-3,5H2,1H3 |
| InChIKey | IUGMJAZDQQWTBB-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.27 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |