C10H17N3S — CID 107649106
N-(2,3-dimethylcyclohexyl)thiadiazol-5-amine (PubChem CID 107649106) has the molecular formula C10H17N3S and a molecular weight of 211.33 g/mol. Its IUPAC name is N-(2,3-dimethylcyclohexyl)thiadiazol-5-amine.
| Compound Name | N-(2,3-dimethylcyclohexyl)thiadiazol-5-amine |
|---|---|
| PubChem CID | 107649106 |
| Molecular Formula | C10H17N3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | N-(2,3-dimethylcyclohexyl)thiadiazol-5-amine |
| SMILES | CC1CCCC(Nc2cnns2)C1C |
| InChI | InChI=1S/C10H17N3S/c1-7-4-3-5-9(8(7)2)12-10-6-11-13-14-10/h6-9,12H,3-5H2,1-2H3 |
| InChIKey | VWFIVTGNAXQLGS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |