C6H5BrF2N2O2S — CID 130487015
N-(5-bromo-3-pyridinyl)-1,1-difluoromethanesulfonamide (PubChem CID 130487015) has the molecular formula C6H5BrF2N2O2S and a molecular weight of 287.09 g/mol. Its IUPAC name is N-(5-bromo-3-pyridinyl)-1,1-difluoromethanesulfonamide.
| Compound Name | N-(5-bromo-3-pyridinyl)-1,1-difluoromethanesulfonamide |
|---|---|
| PubChem CID | 130487015 |
| Molecular Formula | C6H5BrF2N2O2S |
| Molecular Weight | 287.09 g/mol |
| Exact Mass | 285.92 |
| IUPAC Name | N-(5-bromo-3-pyridinyl)-1,1-difluoromethanesulfonamide |
| SMILES | O=S(=O)(Nc1cncc(Br)c1)C(F)F |
| InChI | InChI=1S/C6H5BrF2N2O2S/c7-4-1-5(3-10-2-4)11-14(12,13)6(8)9/h1-3,6,11H |
| InChIKey | XSVCHOGAVFJAGF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.09 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |