C12H19BrN2O2S — CID 75422660
5-bromo-N-(2,2-dimethyl-4-methylsulfonylbutyl)pyridin-3-amine (PubChem CID 75422660) has the molecular formula C12H19BrN2O2S and a molecular weight of 335.27 g/mol. Its IUPAC name is 5-bromo-N-(2,2-dimethyl-4-methylsulfonylbutyl)pyridin-3-amine.
| Compound Name | 5-bromo-N-(2,2-dimethyl-4-methylsulfonylbutyl)pyridin-3-amine |
|---|---|
| PubChem CID | 75422660 |
| Molecular Formula | C12H19BrN2O2S |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 5-bromo-N-(2,2-dimethyl-4-methylsulfonylbutyl)pyridin-3-amine |
| SMILES | CC(C)(CCS(C)(=O)=O)CNc1cncc(Br)c1 |
| InChI | InChI=1S/C12H19BrN2O2S/c1-12(2,4-5-18(3,16)17)9-15-11-6-10(13)7-14-8-11/h6-8,15H,4-5,9H2,1-3H3 |
| InChIKey | WKWSAHSAFVNYEY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |