About 1-[2,2-dimethyl-3-(oxan-4-yl)cyclopropyl]-N-methylmethanamine
1-[2,2-dimethyl-3-(oxan-4-yl)cyclopropyl]-N-methylmethanamine (PubChem CID 130488753) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is 1-[2,2-dimethyl-3-(oxan-4-yl)cyclopropyl]-N-methylmethanamine.
Molecular Properties
| Compound Name | 1-[2,2-dimethyl-3-(oxan-4-yl)cyclopropyl]-N-methylmethanamine |
| PubChem CID | 130488753 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 1-[2,2-dimethyl-3-(oxan-4-yl)cyclopropyl]-N-methylmethanamine |
| SMILES | CNCC1C(C2CCOCC2)C1(C)C |
| InChI | InChI=1S/C12H23NO/c1-12(2)10(8-13-3)11(12)9-4-6-14-7-5-9/h9-11,13H,4-8H2,1-3H3 |
| InChIKey | FTTZIUVHGNAULI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[2,2-dimethyl-3-(oxan-4-yl)cyclopropyl]-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,2-dimethyl-3-(oxan-4-yl)cyclopropyl]-N-methylmethanamine?
The IUPAC name of 1-[2,2-dimethyl-3-(oxan-4-yl)cyclopropyl]-N-methylmethanamine (CID 130488753) is 1-[2,2-dimethyl-3-(oxan-4-yl)cyclopropyl]-N-methylmethanamine.
What is the SMILES notation for 1-[2,2-dimethyl-3-(oxan-4-yl)cyclopropyl]-N-methylmethanamine?
The canonical SMILES for 1-[2,2-dimethyl-3-(oxan-4-yl)cyclopropyl]-N-methylmethanamine is CNCC1C(C2CCOCC2)C1(C)C.
What is the InChIKey of 1-[2,2-dimethyl-3-(oxan-4-yl)cyclopropyl]-N-methylmethanamine?
The InChIKey is FTTZIUVHGNAULI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO/c1-12(2)10(8-13-3)11(12)9-4-6-14-7-5-9/h9-11,13H,4-8H2,1-3H3.
What are the key properties of 1-[2,2-dimethyl-3-(oxan-4-yl)cyclopropyl]-N-methylmethanamine?
1-[2,2-dimethyl-3-(oxan-4-yl)cyclopropyl]-N-methylmethanamine has a molecular weight of 197.32 g/mol, XLogP of 1.90, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,2-dimethyl-3-(oxan-4-yl)cyclopropyl]-N-methylmethanamine is sourced from PubChem (CID 130488753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).