C13H23Br — CID 130489296
1-[3-(bromomethyl)-2,2-dimethylcyclopropyl]-4-methylcyclohexane (PubChem CID 130489296) has the molecular formula C13H23Br and a molecular weight of 259.23 g/mol. Its IUPAC name is 1-[3-(bromomethyl)-2,2-dimethylcyclopropyl]-4-methylcyclohexane.
| Compound Name | 1-[3-(bromomethyl)-2,2-dimethylcyclopropyl]-4-methylcyclohexane |
|---|---|
| PubChem CID | 130489296 |
| Molecular Formula | C13H23Br |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 1-[3-(bromomethyl)-2,2-dimethylcyclopropyl]-4-methylcyclohexane |
| SMILES | CC1CCC(C2C(CBr)C2(C)C)CC1 |
| InChI | InChI=1S/C13H23Br/c1-9-4-6-10(7-5-9)12-11(8-14)13(12,2)3/h9-12H,4-8H2,1-3H3 |
| InChIKey | GMOQUBISDKMUHW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|