About 4-cyclopropyloxane;ethane;N-methylacetamide
4-cyclopropyloxane;ethane;N-methylacetamide (PubChem CID 157037598) has the molecular formula C15H33NO2
and a molecular weight of 259.43 g/mol. Its IUPAC name is 4-cyclopropyloxane;ethane;N-methylacetamide.
Molecular Properties
| Compound Name | 4-cyclopropyloxane;ethane;N-methylacetamide |
| PubChem CID | 157037598 |
| Molecular Formula | C15H33NO2 |
| Molecular Weight | 259.43 g/mol |
| Exact Mass | 259.25 |
| IUPAC Name | 4-cyclopropyloxane;ethane;N-methylacetamide |
| SMILES | C1CC(C2CC2)CCO1.CC.CC.CNC(C)=O |
| InChI | InChI=1S/C8H14O.C3H7NO.2C2H6/c1-2-7(1)8-3-5-9-6-4-8;1-3(5)4-2;2*1-2/h7-8H,1-6H2;1-2H3,(H,4,5);2*1-2H3 |
| InChIKey | NBSWBPNCVSGOCB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-cyclopropyloxane;ethane;N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyloxane;ethane;N-methylacetamide?
The IUPAC name of 4-cyclopropyloxane;ethane;N-methylacetamide (CID 157037598) is 4-cyclopropyloxane;ethane;N-methylacetamide.
What is the SMILES notation for 4-cyclopropyloxane;ethane;N-methylacetamide?
The canonical SMILES for 4-cyclopropyloxane;ethane;N-methylacetamide is C1CC(C2CC2)CCO1.CC.CC.CNC(C)=O.
What is the InChIKey of 4-cyclopropyloxane;ethane;N-methylacetamide?
The InChIKey is NBSWBPNCVSGOCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O.C3H7NO.2C2H6/c1-2-7(1)8-3-5-9-6-4-8;1-3(5)4-2;2*1-2/h7-8H,1-6H2;1-2H3,(H,4,5);2*1-2H3.
What are the key properties of 4-cyclopropyloxane;ethane;N-methylacetamide?
4-cyclopropyloxane;ethane;N-methylacetamide has a molecular weight of 259.43 g/mol, XLogP of 3.63, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyloxane;ethane;N-methylacetamide is sourced from PubChem (CID 157037598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).