C12H13NO4 — CID 13049202
ethyl (4R,5R)-2-oxo-5-phenyl-1,3-oxazolidine-4-carboxylate (PubChem CID 13049202) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is ethyl (4R,5R)-2-oxo-5-phenyl-1,3-oxazolidine-4-carboxylate.
| Compound Name | ethyl (4R,5R)-2-oxo-5-phenyl-1,3-oxazolidine-4-carboxylate |
|---|---|
| PubChem CID | 13049202 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | ethyl (4R,5R)-2-oxo-5-phenyl-1,3-oxazolidine-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1NC(=O)O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C12H13NO4/c1-2-16-11(14)9-10(17-12(15)13-9)8-6-4-3-5-7-8/h3-7,9-10H,2H2,1H3,(H,13,15)/t9-,10-/m1/s1 |
| InChIKey | CBMKQFLEECGXRA-NXEZZACHSA-N |
| XLogP | 1.40 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |