C7H3BrF2O3S — CID 130501681
3-(5-bromothiophen-2-yl)-2,2-difluoro-3-oxopropanoic acid (PubChem CID 130501681) has the molecular formula C7H3BrF2O3S and a molecular weight of 285.06 g/mol. Its IUPAC name is 3-(5-bromothiophen-2-yl)-2,2-difluoro-3-oxopropanoic acid.
| Compound Name | 3-(5-bromothiophen-2-yl)-2,2-difluoro-3-oxopropanoic acid |
|---|---|
| PubChem CID | 130501681 |
| Molecular Formula | C7H3BrF2O3S |
| Molecular Weight | 285.06 g/mol |
| Exact Mass | 283.90 |
| IUPAC Name | 3-(5-bromothiophen-2-yl)-2,2-difluoro-3-oxopropanoic acid |
| SMILES | O=C(O)C(F)(F)C(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C7H3BrF2O3S/c8-4-2-1-3(14-4)5(11)7(9,10)6(12)13/h1-2H,(H,12,13) |
| InChIKey | ZKRJNVAMLUSGNA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.06 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|