C14H6Br2F8O2S2 — CID 160871136
1-(5-bromothiophen-2-yl)-2,2,3,3-tetrafluoropropan-1-one (PubChem CID 160871136) has the molecular formula C14H6Br2F8O2S2 and a molecular weight of 582.13 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-2,2,3,3-tetrafluoropropan-1-one.
| Compound Name | 1-(5-bromothiophen-2-yl)-2,2,3,3-tetrafluoropropan-1-one |
|---|---|
| PubChem CID | 160871136 |
| Molecular Formula | C14H6Br2F8O2S2 |
| Molecular Weight | 582.13 g/mol |
| Exact Mass | 579.80 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-2,2,3,3-tetrafluoropropan-1-one |
| SMILES | O=C(c1ccc(Br)s1)C(F)(F)C(F)F.O=C(c1ccc(Br)s1)C(F)(F)C(F)F |
| InChI | InChI=1S/2C7H3BrF4OS/c2*8-4-2-1-3(14-4)5(13)7(11,12)6(9)10/h2*1-2,6H |
| InChIKey | SLTRVLZRTVBDQL-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.13 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|